About methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate
methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate (PubChem CID 15517724) has the molecular formula C23H21F3O5S
and a molecular weight of 466.48 g/mol. Its IUPAC name is methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
| PubChem CID | 15517724 |
| Molecular Formula | C23H21F3O5S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/c2ccc3c(c2)C(OS(=O)(=O)C(F)(F)F)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C23H21F3O5S/c1-22(2)13-12-20(31-32(28,29)23(24,25)26)18-14-16(8-11-19(18)22)5-4-15-6-9-17(10-7-15)21(27)30-3/h4-12,14H,13H2,1-3H3/b5-4+ |
| InChIKey | VCCAQJIGEWOOLB-SNAWJCMRSA-N |
| XLogP | 5.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate?
The IUPAC name of methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate (CID 15517724) is methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate.
What is the SMILES notation for methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate?
The canonical SMILES for methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate is COC(=O)c1ccc(/C=C/c2ccc3c(c2)C(OS(=O)(=O)C(F)(F)F)=CCC3(C)C)cc1.
What is the InChIKey of methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate?
The InChIKey is VCCAQJIGEWOOLB-SNAWJCMRSA-N. The full InChI is InChI=1S/C23H21F3O5S/c1-22(2)13-12-20(31-32(28,29)23(24,25)26)18-14-16(8-11-19(18)22)5-4-15-6-9-17(10-7-15)21(27)30-3/h4-12,14H,13H2,1-3H3/b5-4+.
What are the key properties of methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate?
methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate has a molecular weight of 466.48 g/mol, XLogP of 5.53, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate is sourced from PubChem (CID 15517724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).