C19H39N3O — CID 155177323
1-methoxy-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine (PubChem CID 155177323) has the molecular formula C19H39N3O and a molecular weight of 325.54 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine.
| Compound Name | 1-methoxy-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 155177323 |
| Molecular Formula | C19H39N3O |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.31 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine |
| SMILES | CON1C(C)(C)CC(NC2CC(C)(C)NC(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C19H39N3O/c1-16(2)10-14(11-17(3,4)21-16)20-15-12-18(5,6)22(23-9)19(7,8)13-15/h14-15,20-21H,10-13H2,1-9H3 |
| InChIKey | PIEAEJANBUPLKF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |