C46H48F2N8O6 — CID 155178190
5-[6-[4-[4-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyrazol-1-yl]piperidin-1-yl]hexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 155178190) has the molecular formula C46H48F2N8O6 and a molecular weight of 846.94 g/mol. Its IUPAC name is 5-[6-[4-[4-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyrazol-1-yl]piperidin-1-yl]hexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[6-[4-[4-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyrazol-1-yl]piperidin-1-yl]hexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155178190 |
| Molecular Formula | C46H48F2N8O6 |
| Molecular Weight | 846.94 g/mol |
| Exact Mass | 846.37 |
| IUPAC Name | 5-[6-[4-[4-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyrazol-1-yl]piperidin-1-yl]hexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCCCCCN4CCC(n5cc(-c6cnc7cccc(-c8cc(F)c(CN9CCOCC9)c(F)c8)c7n6)cn5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C46H48F2N8O6/c47-37-22-29(23-38(48)36(37)28-54-17-20-61-21-18-54)33-6-5-7-39-43(33)51-40(26-49-39)30-25-50-55(27-30)31-12-15-53(16-13-31)14-3-1-2-4-19-62-32-8-9-34-35(24-32)46(60)56(45(34)59)41-10-11-42(57)52-44(41)58/h5-9,22-27,31,41H,1-4,10-21,28H2,(H,52,57,58) |
| InChIKey | IIBZINBMIQGRRB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|