About tert-butyl 6-methyliminohexanoate
tert-butyl 6-methyliminohexanoate (PubChem CID 155178229) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is tert-butyl 6-methyliminohexanoate.
Molecular Properties
| Compound Name | tert-butyl 6-methyliminohexanoate |
| PubChem CID | 155178229 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | tert-butyl 6-methyliminohexanoate |
| SMILES | C/N=C/CCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-11(2,3)14-10(13)8-6-5-7-9-12-4/h9H,5-8H2,1-4H3/b12-9+ |
| InChIKey | DVMHRLMJBHNJPI-FMIVXFBMSA-N |
| XLogP | 2.59 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-methyliminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-methyliminohexanoate?
The IUPAC name of tert-butyl 6-methyliminohexanoate (CID 155178229) is tert-butyl 6-methyliminohexanoate.
What is the SMILES notation for tert-butyl 6-methyliminohexanoate?
The canonical SMILES for tert-butyl 6-methyliminohexanoate is C/N=C/CCCCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 6-methyliminohexanoate?
The InChIKey is DVMHRLMJBHNJPI-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H21NO2/c1-11(2,3)14-10(13)8-6-5-7-9-12-4/h9H,5-8H2,1-4H3/b12-9+.
What are the key properties of tert-butyl 6-methyliminohexanoate?
tert-butyl 6-methyliminohexanoate has a molecular weight of 199.29 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-methyliminohexanoate is sourced from PubChem (CID 155178229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).