C24H29F3N6O2 — CID 155178535
4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-(3,3,3-trifluoropropylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 155178535) has the molecular formula C24H29F3N6O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-(3,3,3-trifluoropropylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-(3,3,3-trifluoropropylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 155178535 |
| Molecular Formula | C24H29F3N6O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-(3,3,3-trifluoropropylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | OC1CCC(c2cc(-c3ccnc(N4CCOCC4)c3)c3cnc(NCCC(F)(F)F)nn23)CC1 |
| InChI | InChI=1S/C24H29F3N6O2/c25-24(26,27)6-8-29-23-30-15-21-19(14-20(33(21)31-23)16-1-3-18(34)4-2-16)17-5-7-28-22(13-17)32-9-11-35-12-10-32/h5,7,13-16,18,34H,1-4,6,8-12H2,(H,29,31) |
| InChIKey | XRSZYCAOPGBGSV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |