C23H27F3N6O2 — CID 155178543
5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N-methylpyridine-3-carboxamide (PubChem CID 155178543) has the molecular formula C23H27F3N6O2 and a molecular weight of 476.50 g/mol. Its IUPAC name is 5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N-methylpyridine-3-carboxamide.
| Compound Name | 5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155178543 |
| Molecular Formula | C23H27F3N6O2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(-c2cc(C3CCC(O)CC3)n3nc(N[C@@H](C)CC(F)(F)F)ncc23)c1 |
| InChI | InChI=1S/C23H27F3N6O2/c1-13(9-23(24,25)26)30-22-29-12-20-18(15-7-16(11-28-10-15)21(34)27-2)8-19(32(20)31-22)14-3-5-17(33)6-4-14/h7-8,10-14,17,33H,3-6,9H2,1-2H3,(H,27,34)(H,30,31)/t13-,14?,17?/m0/s1 |
| InChIKey | BMZVQDJTVYAVNA-CBCUQQMYSA-N |
| XLogP | 3.92 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |