C24H32F3N7O2 — CID 155178546
4-[2-[[(2S)-1-methoxypropan-2-yl]amino]-5-[1-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 155178546) has the molecular formula C24H32F3N7O2 and a molecular weight of 507.56 g/mol. Its IUPAC name is 4-[2-[[(2S)-1-methoxypropan-2-yl]amino]-5-[1-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-[[(2S)-1-methoxypropan-2-yl]amino]-5-[1-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 155178546 |
| Molecular Formula | C24H32F3N7O2 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 4-[2-[[(2S)-1-methoxypropan-2-yl]amino]-5-[1-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | COC[C@H](C)Nc1ncc2c(-c3cnn(C4CN(CC(F)(F)F)C4)c3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C24H32F3N7O2/c1-15(13-36-2)30-23-28-9-22-20(7-21(34(22)31-23)16-3-5-19(35)6-4-16)17-8-29-33(10-17)18-11-32(12-18)14-24(25,26)27/h7-10,15-16,18-19,35H,3-6,11-14H2,1-2H3,(H,30,31)/t15-,16?,19?/m0/s1 |
| InChIKey | WBDXOOJXNXIVSI-LYGPFTKASA-N |
| XLogP | 3.48 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |