C26H31F3N6O3 — CID 155178636
[5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 155178636) has the molecular formula C26H31F3N6O3 and a molecular weight of 532.57 g/mol. Its IUPAC name is [5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155178636 |
| Molecular Formula | C26H31F3N6O3 |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | [5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | C[C@@H](CC(F)(F)F)Nc1ncc2c(-c3cncc(C(=O)N4CCOCC4)c3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C26H31F3N6O3/c1-16(12-26(27,28)29)32-25-31-15-23-21(11-22(35(23)33-25)17-2-4-20(36)5-3-17)18-10-19(14-30-13-18)24(37)34-6-8-38-9-7-34/h10-11,13-17,20,36H,2-9,12H2,1H3,(H,32,33)/t16-,17?,20?/m0/s1 |
| InChIKey | HYICQCZVVFVKPR-VXESANQCSA-N |
| XLogP | 4.03 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |