C24H29F3N6O2 — CID 155178645
5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 155178645) has the molecular formula C24H29F3N6O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155178645 |
| Molecular Formula | C24H29F3N6O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 5-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | C[C@@H](CC(F)(F)F)Nc1ncc2c(-c3cncc(C(=O)N(C)C)c3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C24H29F3N6O2/c1-14(10-24(25,26)27)30-23-29-13-21-19(16-8-17(12-28-11-16)22(35)32(2)3)9-20(33(21)31-23)15-4-6-18(34)7-5-15/h8-9,11-15,18,34H,4-7,10H2,1-3H3,(H,30,31)/t14-,15?,18?/m0/s1 |
| InChIKey | AGQOQUJIMSZBOW-SYJJWHGVSA-N |
| XLogP | 4.26 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |