C26H34F3N7O3 — CID 155178661
2-[4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]pyrazol-1-yl]-2-methyl-1-morpholin-4-ylpropan-1-one (PubChem CID 155178661) has the molecular formula C26H34F3N7O3 and a molecular weight of 549.60 g/mol. Its IUPAC name is 2-[4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]pyrazol-1-yl]-2-methyl-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-[4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]pyrazol-1-yl]-2-methyl-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 155178661 |
| Molecular Formula | C26H34F3N7O3 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 2-[4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]pyrazol-1-yl]-2-methyl-1-morpholin-4-ylpropan-1-one |
| SMILES | C[C@H](Nc1ncc2c(-c3cnn(C(C)(C)C(=O)N4CCOCC4)c3)cc(C3CCC(O)CC3)n2n1)C(F)(F)F |
| InChI | InChI=1S/C26H34F3N7O3/c1-16(26(27,28)29)32-24-30-14-22-20(12-21(36(22)33-24)17-4-6-19(37)7-5-17)18-13-31-35(15-18)25(2,3)23(38)34-8-10-39-11-9-34/h12-17,19,37H,4-11H2,1-3H3,(H,32,33)/t16-,17?,19?/m0/s1 |
| InChIKey | HWQRBVPSPGDYFU-MUYFXNHWSA-N |
| XLogP | 3.57 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |