C25H31F3N6O2 — CID 155178705
4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 155178705) has the molecular formula C25H31F3N6O2 and a molecular weight of 504.56 g/mol. Its IUPAC name is 4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 155178705 |
| Molecular Formula | C25H31F3N6O2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-[5-(2-morpholin-4-yl-4-pyridinyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | C[C@@H](CC(F)(F)F)Nc1ncc2c(-c3ccnc(N4CCOCC4)c3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C25H31F3N6O2/c1-16(14-25(26,27)28)31-24-30-15-22-20(13-21(34(22)32-24)17-2-4-19(35)5-3-17)18-6-7-29-23(12-18)33-8-10-36-11-9-33/h6-7,12-13,15-17,19,35H,2-5,8-11,14H2,1H3,(H,31,32)/t16-,17?,19?/m0/s1 |
| InChIKey | JVGBZPROSYVBMU-MUYFXNHWSA-N |
| XLogP | 4.40 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |