C23H26F3N5O2 — CID 155178720
4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-6-methylpyridine-2-carbaldehyde (PubChem CID 155178720) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is 4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-6-methylpyridine-2-carbaldehyde.
| Compound Name | 4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-6-methylpyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 155178720 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-6-methylpyridine-2-carbaldehyde |
| SMILES | Cc1cc(-c2cc(C3CCC(O)CC3)n3nc(N[C@@H](C)CC(F)(F)F)ncc23)cc(C=O)n1 |
| InChI | InChI=1S/C23H26F3N5O2/c1-13-7-16(8-17(12-32)28-13)19-9-20(15-3-5-18(33)6-4-15)31-21(19)11-27-22(30-31)29-14(2)10-23(24,25)26/h7-9,11-12,14-15,18,33H,3-6,10H2,1-2H3,(H,29,30)/t14-,15?,18?/m0/s1 |
| InChIKey | XPHAZNARHSAHKG-SYJJWHGVSA-N |
| XLogP | 4.68 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|