C27H38F3N5O3 — CID 155178771
[4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohexyl]-morpholin-4-ylmethanone (PubChem CID 155178771) has the molecular formula C27H38F3N5O3 and a molecular weight of 537.63 g/mol. Its IUPAC name is [4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohexyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohexyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155178771 |
| Molecular Formula | C27H38F3N5O3 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | [4-[7-(4-hydroxycyclohexyl)-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohexyl]-morpholin-4-ylmethanone |
| SMILES | C[C@@H](CC(F)(F)F)Nc1ncc2c(C3CCC(C(=O)N4CCOCC4)CC3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C27H38F3N5O3/c1-17(15-27(28,29)30)32-26-31-16-24-22(14-23(35(24)33-26)19-6-8-21(36)9-7-19)18-2-4-20(5-3-18)25(37)34-10-12-38-13-11-34/h14,16-21,36H,2-13,15H2,1H3,(H,32,33)/t17-,18?,19?,20?,21?/m0/s1 |
| InChIKey | KPYXCKOADMQCQW-OXAFFQKASA-N |
| XLogP | 4.63 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |