C22H27F3N6O2 — CID 155178845
4-[5-[1-(oxetan-3-yl)pyrazol-4-yl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 155178845) has the molecular formula C22H27F3N6O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is 4-[5-[1-(oxetan-3-yl)pyrazol-4-yl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-[1-(oxetan-3-yl)pyrazol-4-yl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 155178845 |
| Molecular Formula | C22H27F3N6O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[5-[1-(oxetan-3-yl)pyrazol-4-yl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | C[C@@H](CC(F)(F)F)Nc1ncc2c(-c3cnn(C4COC4)c3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C22H27F3N6O2/c1-13(7-22(23,24)25)28-21-26-9-20-18(15-8-27-30(10-15)16-11-33-12-16)6-19(31(20)29-21)14-2-4-17(32)5-3-14/h6,8-10,13-14,16-17,32H,2-5,7,11-12H2,1H3,(H,28,29)/t13-,14?,17?/m0/s1 |
| InChIKey | XZJTUIMPOFEZIB-CBCUQQMYSA-N |
| XLogP | 3.94 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |