C27H34F3N5O2 — CID 155178898
4-[5-[4-(morpholin-4-ylmethyl)phenyl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 155178898) has the molecular formula C27H34F3N5O2 and a molecular weight of 517.60 g/mol. Its IUPAC name is 4-[5-[4-(morpholin-4-ylmethyl)phenyl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-[4-(morpholin-4-ylmethyl)phenyl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 155178898 |
| Molecular Formula | C27H34F3N5O2 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 4-[5-[4-(morpholin-4-ylmethyl)phenyl]-2-[[(2S)-4,4,4-trifluorobutan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | C[C@@H](CC(F)(F)F)Nc1ncc2c(-c3ccc(CN4CCOCC4)cc3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C27H34F3N5O2/c1-18(15-27(28,29)30)32-26-31-16-25-23(14-24(35(25)33-26)21-6-8-22(36)9-7-21)20-4-2-19(3-5-20)17-34-10-12-37-13-11-34/h2-5,14,16,18,21-22,36H,6-13,15,17H2,1H3,(H,32,33)/t18-,21?,22?/m0/s1 |
| InChIKey | RQNIOCBXGGNEKZ-XTWGIRIWSA-N |
| XLogP | 5.00 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |