C31H43N5O3 — CID 155179091
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(oxepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid (PubChem CID 155179091) has the molecular formula C31H43N5O3 and a molecular weight of 533.72 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(oxepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(oxepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 155179091 |
| Molecular Formula | C31H43N5O3 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(oxepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C(=O)O)cc1Cn1ccnc1CC1CCCOCC1 |
| InChI | InChI=1S/C31H43N5O3/c1-20-8-9-23(18-24(20)19-36-14-13-34-27(36)17-22-7-6-15-39-16-12-22)28(31(3,4)30(37)38)25-10-11-26(35(5)33)29(32)21(25)2/h8-11,13-14,18,22,28H,6-7,12,15-17,19,32-33H2,1-5H3,(H,37,38) |
| InChIKey | SJMUNHAIGNMZHC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|