C15H19F5O2S — CID 155179598
1,2,3,4,5-pentafluoro-6-nonan-4-ylsulfonylbenzene (PubChem CID 155179598) has the molecular formula C15H19F5O2S and a molecular weight of 358.37 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-nonan-4-ylsulfonylbenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-nonan-4-ylsulfonylbenzene |
|---|---|
| PubChem CID | 155179598 |
| Molecular Formula | C15H19F5O2S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-nonan-4-ylsulfonylbenzene |
| SMILES | CCCCCC(CCC)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H19F5O2S/c1-3-5-6-8-9(7-4-2)23(21,22)15-13(19)11(17)10(16)12(18)14(15)20/h9H,3-8H2,1-2H3 |
| InChIKey | ZWWLIEKOAABVHJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|