C69H47N5 — CID 155179722
2-carbazol-9-yl-9-[(1Z,3Z)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-bis(4-phenylphenyl)hexa-1,3,5-trien-2-yl]carbazole (PubChem CID 155179722) has the molecular formula C69H47N5 and a molecular weight of 946.17 g/mol. Its IUPAC name is 2-carbazol-9-yl-9-[(1Z,3Z)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-bis(4-phenylphenyl)hexa-1,3,5-trien-2-yl]carbazole.
| Compound Name | 2-carbazol-9-yl-9-[(1Z,3Z)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-bis(4-phenylphenyl)hexa-1,3,5-trien-2-yl]carbazole |
|---|---|
| PubChem CID | 155179722 |
| Molecular Formula | C69H47N5 |
| Molecular Weight | 946.17 g/mol |
| Exact Mass | 945.38 |
| IUPAC Name | 2-carbazol-9-yl-9-[(1Z,3Z)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-bis(4-phenylphenyl)hexa-1,3,5-trien-2-yl]carbazole |
| SMILES | C=C(/C=C(C(=C\c1ccc(-c2ccccc2)cc1)\n1c2ccccc2c2ccc(-n3c4ccccc4c4ccccc43)cc21)/c1ccc(-c2ccccc2)cc1)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C69H47N5/c1-47(67-70-68(54-24-10-4-11-25-54)72-69(71-67)55-26-12-5-13-27-55)44-61(53-40-38-52(39-41-53)50-22-8-3-9-23-50)65(45-48-34-36-51(37-35-48)49-20-6-2-7-21-49)74-64-33-19-16-30-59(64)60-43-42-56(46-66(60)74)73-62-31-17-14-28-57(62)58-29-15-18-32-63(58)73/h2-46H,1H2/b61-44-,65-45- |
| InChIKey | NYGNROREFWIYFO-SRWXSIBHSA-N |
| XLogP | 17.54 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.17 |
| LogP ≤ 5 | 17.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|