C75H51N5 — CID 155179799
5-[4-[4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-12-phenylindolo[3,2-c]carbazole (PubChem CID 155179799) has the molecular formula C75H51N5 and a molecular weight of 1022.27 g/mol. Its IUPAC name is 5-[4-[4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-12-phenylindolo[3,2-c]carbazole.
| Compound Name | 5-[4-[4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-12-phenylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 155179799 |
| Molecular Formula | C75H51N5 |
| Molecular Weight | 1022.27 g/mol |
| Exact Mass | 1021.41 |
| IUPAC Name | 5-[4-[4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-12-phenylindolo[3,2-c]carbazole |
| SMILES | C1=CCC(c2ccc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4cc(-c5ccccc5)c(-n5c6ccccc6c6c5ccc5c7ccccc7n(-c7ccccc7)c56)c(-c5ccccc5)c4)n3)cc2)C=C1 |
| InChI | InChI=1S/C75H51N5/c1-7-23-50(24-8-1)53-39-41-56(42-40-53)73-76-74(59-46-57(51-25-9-2-10-26-51)45-58(47-59)52-27-11-3-12-28-52)78-75(77-73)60-48-65(54-29-13-4-14-30-54)71(66(49-60)55-31-15-5-16-32-55)80-68-38-22-20-36-64(68)70-69(80)44-43-63-62-35-19-21-37-67(62)79(72(63)70)61-33-17-6-18-34-61/h1-23,25-50H,24H2 |
| InChIKey | FNGVPLQKNZGTRJ-UHFFFAOYSA-N |
| XLogP | 19.33 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.27 |
| LogP ≤ 5 | 19.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |