C32H61N3O4 — CID 155180199
nonyl 8-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propyl-octylamino]octanoate (PubChem CID 155180199) has the molecular formula C32H61N3O4 and a molecular weight of 551.86 g/mol. Its IUPAC name is nonyl 8-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propyl-octylamino]octanoate.
| Compound Name | nonyl 8-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propyl-octylamino]octanoate |
|---|---|
| PubChem CID | 155180199 |
| Molecular Formula | C32H61N3O4 |
| Molecular Weight | 551.86 g/mol |
| Exact Mass | 551.47 |
| IUPAC Name | nonyl 8-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propyl-octylamino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C32H61N3O4/c1-4-6-8-10-12-17-21-28-39-31(37)23-18-14-13-16-20-25-34(24-19-15-11-9-7-5-2)26-22-27-35-30(36)29-33(3)32(35)38/h4-29H2,1-3H3 |
| InChIKey | BAJSJGHYOOUCJR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.86 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|