C26H24F6N2O3 — CID 155181088
N'-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]heptanediamide (PubChem CID 155181088) has the molecular formula C26H24F6N2O3 and a molecular weight of 526.48 g/mol. Its IUPAC name is N'-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]heptanediamide.
| Compound Name | N'-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]heptanediamide |
|---|---|
| PubChem CID | 155181088 |
| Molecular Formula | C26H24F6N2O3 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N'-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]heptanediamide |
| SMILES | NC(=O)CCCCCC(=O)Nc1ccc2c(c1)CC/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C26H24F6N2O3/c27-25(28,29)18-11-15(12-19(14-18)26(30,31)32)10-17-7-6-16-13-20(8-9-21(16)24(17)37)34-23(36)5-3-1-2-4-22(33)35/h8-14H,1-7H2,(H2,33,35)(H,34,36)/b17-10+ |
| InChIKey | UAHMWSQJNRNRLD-LICLKQGHSA-N |
| XLogP | 6.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|