C26H29Cl2N3O3 — CID 155181103
N'-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide (PubChem CID 155181103) has the molecular formula C26H29Cl2N3O3 and a molecular weight of 502.44 g/mol. Its IUPAC name is N'-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide.
| Compound Name | N'-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide |
|---|---|
| PubChem CID | 155181103 |
| Molecular Formula | C26H29Cl2N3O3 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N'-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide |
| SMILES | NC(=O)CCCCCCC(=O)NC1CCc2cc(/C=C/C(=O)Nc3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C26H29Cl2N3O3/c27-19-14-20(28)16-21(15-19)30-26(34)12-8-17-7-10-22-18(13-17)9-11-23(22)31-25(33)6-4-2-1-3-5-24(29)32/h7-8,10,12-16,23H,1-6,9,11H2,(H2,29,32)(H,30,34)(H,31,33)/b12-8+ |
| InChIKey | AAQSYVKLTPLEKL-XYOKQWHBSA-N |
| XLogP | 5.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|