C23H20F6N2O4 — CID 155181296
[3,5-bis(trifluoromethyl)phenyl]methyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-methylcarbamate (PubChem CID 155181296) has the molecular formula C23H20F6N2O4 and a molecular weight of 502.41 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-methylcarbamate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155181296 |
| Molecular Formula | C23H20F6N2O4 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCc2cc(/C=C/C(=O)NO)ccc21 |
| InChI | InChI=1S/C23H20F6N2O4/c1-31(19-6-4-15-8-13(2-5-18(15)19)3-7-20(32)30-34)21(33)35-12-14-9-16(22(24,25)26)11-17(10-14)23(27,28)29/h2-3,5,7-11,19,34H,4,6,12H2,1H3,(H,30,32)/b7-3+ |
| InChIKey | KECDKIWZKXJIQS-XVNBXDOJSA-N |
| XLogP | 5.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|