C26H29FN2O4 — CID 155181440
methyl 6-[[(E)-3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoyl]amino]hexanoate (PubChem CID 155181440) has the molecular formula C26H29FN2O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is methyl 6-[[(E)-3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoyl]amino]hexanoate.
| Compound Name | methyl 6-[[(E)-3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 155181440 |
| Molecular Formula | C26H29FN2O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | methyl 6-[[(E)-3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)/C=C/c1ccc2c(c1)CCC2NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H29FN2O4/c1-33-25(31)5-3-2-4-16-28-24(30)15-7-18-6-13-22-20(17-18)10-14-23(22)29-26(32)19-8-11-21(27)12-9-19/h6-9,11-13,15,17,23H,2-5,10,14,16H2,1H3,(H,28,30)(H,29,32)/b15-7+ |
| InChIKey | ALIBNHVFKLGBFB-VIZOYTHASA-N |
| XLogP | 4.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|