C22H17F6NO4 — CID 155181450
(E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid (PubChem CID 155181450) has the molecular formula C22H17F6NO4 and a molecular weight of 473.37 g/mol. Its IUPAC name is (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155181450 |
| Molecular Formula | C22H17F6NO4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2c(c1)CCC2NC(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F6NO4/c23-21(24,25)15-8-13(9-16(10-15)22(26,27)28)11-33-20(32)29-18-5-3-14-7-12(1-4-17(14)18)2-6-19(30)31/h1-2,4,6-10,18H,3,5,11H2,(H,29,32)(H,30,31)/b6-2+ |
| InChIKey | CAYHFUPVYNBIFT-QHHAFSJGSA-N |
| XLogP | 5.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|