C11H18IN3 — CID 155181524
1-iodo-5,5-dimethyl-4,6,7,8,9,10-hexahydrocyclonona[d]triazole (PubChem CID 155181524) has the molecular formula C11H18IN3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 1-iodo-5,5-dimethyl-4,6,7,8,9,10-hexahydrocyclonona[d]triazole.
| Compound Name | 1-iodo-5,5-dimethyl-4,6,7,8,9,10-hexahydrocyclonona[d]triazole |
|---|---|
| PubChem CID | 155181524 |
| Molecular Formula | C11H18IN3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 1-iodo-5,5-dimethyl-4,6,7,8,9,10-hexahydrocyclonona[d]triazole |
| SMILES | CC1(C)CCCCCc2c(nnn2I)C1 |
| InChI | InChI=1S/C11H18IN3/c1-11(2)7-5-3-4-6-10-9(8-11)13-14-15(10)12/h3-8H2,1-2H3 |
| InChIKey | SAZSZCVYIFYRFV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|