C10H16O2 — CID 155182669
7-ethyl-2,3,4a,5,6,7-hexahydro-1,4-benzodioxine (PubChem CID 155182669) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 7-ethyl-2,3,4a,5,6,7-hexahydro-1,4-benzodioxine.
| Compound Name | 7-ethyl-2,3,4a,5,6,7-hexahydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 155182669 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 7-ethyl-2,3,4a,5,6,7-hexahydro-1,4-benzodioxine |
| SMILES | CCC1C=C2OCCOC2CC1 |
| InChI | InChI=1S/C10H16O2/c1-2-8-3-4-9-10(7-8)12-6-5-11-9/h7-9H,2-6H2,1H3 |
| InChIKey | AFOWQCRNTLRWEZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |