About 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid
4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid (PubChem CID 155182718) has the molecular formula C24H15Cl2F2NO3
and a molecular weight of 474.29 g/mol. Its IUPAC name is 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid.
Molecular Properties
| Compound Name | 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid |
| PubChem CID | 155182718 |
| Molecular Formula | C24H15Cl2F2NO3 |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid |
| SMILES | CCc1cc(-c2c(F)c(C(=O)c3c(Cl)ccc(F)c3Cl)n3ccccc23)ccc1C(=O)O |
| InChI | InChI=1S/C24H15Cl2F2NO3/c1-2-12-11-13(6-7-14(12)24(31)32)18-17-5-3-4-10-29(17)22(21(18)28)23(30)19-15(25)8-9-16(27)20(19)26/h3-11H,2H2,1H3,(H,31,32) |
| InChIKey | NYYLRJPNUZBHEQ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 58.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid?
The IUPAC name of 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid (CID 155182718) is 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid.
What is the SMILES notation for 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid?
The canonical SMILES for 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid is CCc1cc(-c2c(F)c(C(=O)c3c(Cl)ccc(F)c3Cl)n3ccccc23)ccc1C(=O)O.
What is the InChIKey of 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid?
The InChIKey is NYYLRJPNUZBHEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15Cl2F2NO3/c1-2-12-11-13(6-7-14(12)24(31)32)18-17-5-3-4-10-29(17)22(21(18)28)23(30)19-15(25)8-9-16(27)20(19)26/h3-11H,2H2,1H3,(H,31,32).
What are the key properties of 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid?
4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid has a molecular weight of 474.29 g/mol, XLogP of 6.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-dichloro-3-fluorobenzoyl)-2-fluoroindolizin-1-yl]-2-ethylbenzoic acid is sourced from PubChem (CID 155182718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).