About 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea
1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea (PubChem CID 155182788) has the molecular formula C8H12N6O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea.
Molecular Properties
| Compound Name | 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea |
| PubChem CID | 155182788 |
| Molecular Formula | C8H12N6O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea |
| SMILES | NNC(=O)NNC(=O)c1cnn2c1CCC2 |
| InChI | InChI=1S/C8H12N6O2/c9-11-8(16)13-12-7(15)5-4-10-14-3-1-2-6(5)14/h4H,1-3,9H2,(H,12,15)(H2,11,13,16) |
| InChIKey | BXBLWDCWDFABMN-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea?
The IUPAC name of 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea (CID 155182788) is 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea.
What is the SMILES notation for 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea?
The canonical SMILES for 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea is NNC(=O)NNC(=O)c1cnn2c1CCC2.
What is the InChIKey of 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea?
The InChIKey is BXBLWDCWDFABMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6O2/c9-11-8(16)13-12-7(15)5-4-10-14-3-1-2-6(5)14/h4H,1-3,9H2,(H,12,15)(H2,11,13,16).
What are the key properties of 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea?
1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea has a molecular weight of 224.22 g/mol, XLogP of -1.35, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carbonylamino)urea is sourced from PubChem (CID 155182788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).