C22H32IN3O — CID 155183064
1-(cyclobutylmethyl)-8-[ethyl(methyl)amino]-3-iodo-8-phenyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 155183064) has the molecular formula C22H32IN3O and a molecular weight of 481.42 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-8-[ethyl(methyl)amino]-3-iodo-8-phenyl-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-(cyclobutylmethyl)-8-[ethyl(methyl)amino]-3-iodo-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 155183064 |
| Molecular Formula | C22H32IN3O |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-(cyclobutylmethyl)-8-[ethyl(methyl)amino]-3-iodo-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | CCN(C)C1(c2ccccc2)CCC2(CC1)CN(I)C(=O)N2CC1CCC1 |
| InChI | InChI=1S/C22H32IN3O/c1-3-24(2)22(19-10-5-4-6-11-19)14-12-21(13-15-22)17-26(23)20(27)25(21)16-18-8-7-9-18/h4-6,10-11,18H,3,7-9,12-17H2,1-2H3 |
| InChIKey | KBDIDHFBQWPDGB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|