C21H39N3O2 — CID 155183394
2-methyl-3-[1-(5-methyl-4-oxohexyl)piperidin-4-yl]-N-piperidin-3-ylpropanamide (PubChem CID 155183394) has the molecular formula C21H39N3O2 and a molecular weight of 365.56 g/mol. Its IUPAC name is 2-methyl-3-[1-(5-methyl-4-oxohexyl)piperidin-4-yl]-N-piperidin-3-ylpropanamide.
| Compound Name | 2-methyl-3-[1-(5-methyl-4-oxohexyl)piperidin-4-yl]-N-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 155183394 |
| Molecular Formula | C21H39N3O2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | 2-methyl-3-[1-(5-methyl-4-oxohexyl)piperidin-4-yl]-N-piperidin-3-ylpropanamide |
| SMILES | CC(C)C(=O)CCCN1CCC(CC(C)C(=O)NC2CCCNC2)CC1 |
| InChI | InChI=1S/C21H39N3O2/c1-16(2)20(25)7-5-11-24-12-8-18(9-13-24)14-17(3)21(26)23-19-6-4-10-22-15-19/h16-19,22H,4-15H2,1-3H3,(H,23,26) |
| InChIKey | CQQJVKSDUVERAQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |