About 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole
5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole (PubChem CID 155183804) has the molecular formula C11H12ClF3N2
and a molecular weight of 264.68 g/mol. Its IUPAC name is 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole |
| PubChem CID | 155183804 |
| Molecular Formula | C11H12ClF3N2 |
| Molecular Weight | 264.68 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole |
| SMILES | CCc1nc2c([nH]1)C(C)C(F)(C(F)F)C(Cl)=C2 |
| InChI | InChI=1S/C11H12ClF3N2/c1-3-8-16-6-4-7(12)11(15,10(13)14)5(2)9(6)17-8/h4-5,10H,3H2,1-2H3,(H,16,17) |
| InChIKey | YIYAMWQMIBVSGO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole?
The IUPAC name of 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole (CID 155183804) is 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole.
What is the SMILES notation for 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole?
The canonical SMILES for 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole is CCc1nc2c([nH]1)C(C)C(F)(C(F)F)C(Cl)=C2.
What is the InChIKey of 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole?
The InChIKey is YIYAMWQMIBVSGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF3N2/c1-3-8-16-6-4-7(12)11(15,10(13)14)5(2)9(6)17-8/h4-5,10H,3H2,1-2H3,(H,16,17).
What are the key properties of 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole?
5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole has a molecular weight of 264.68 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-(difluoromethyl)-2-ethyl-6-fluoro-7-methyl-1,7-dihydrobenzimidazole is sourced from PubChem (CID 155183804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).