C27H30BrN8O2P — CID 155183914
N-[5-[[5-bromo-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-(butylamino)phenyl]prop-2-enamide (PubChem CID 155183914) has the molecular formula C27H30BrN8O2P and a molecular weight of 609.47 g/mol. Its IUPAC name is N-[5-[[5-bromo-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-(butylamino)phenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-bromo-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-(butylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155183914 |
| Molecular Formula | C27H30BrN8O2P |
| Molecular Weight | 609.47 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | N-[5-[[5-bromo-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-(butylamino)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Br)c(Nc3ccc4nccnc4c3P(C)(C)=O)n2)ccc1NCCCC |
| InChI | InChI=1S/C27H30BrN8O2P/c1-5-7-12-29-19-9-8-17(15-22(19)34-23(37)6-2)33-27-32-16-18(28)26(36-27)35-21-11-10-20-24(31-14-13-30-20)25(21)39(3,4)38/h6,8-11,13-16,29H,2,5,7,12H2,1,3-4H3,(H,34,37)(H2,32,33,35,36) |
| InChIKey | CSBQGFDIMSPJFZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.47 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|