C11H12F3NO — CID 155184251
N-[(1R)-1-cyclohexa-1,5-dien-1-ylprop-2-enyl]-2,2,2-trifluoroacetamide (PubChem CID 155184251) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexa-1,5-dien-1-ylprop-2-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R)-1-cyclohexa-1,5-dien-1-ylprop-2-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 155184251 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-[(1R)-1-cyclohexa-1,5-dien-1-ylprop-2-enyl]-2,2,2-trifluoroacetamide |
| SMILES | C=C[C@@H](NC(=O)C(F)(F)F)C1=CCCC=C1 |
| InChI | InChI=1S/C11H12F3NO/c1-2-9(8-6-4-3-5-7-8)15-10(16)11(12,13)14/h2,4,6-7,9H,1,3,5H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | UYPSOYNHEXNYEJ-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|