C14H21NO — CID 155184988
(3E,5Z)-5-[[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]methyl]hepta-1,3,5-trien-4-ol (PubChem CID 155184988) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (3E,5Z)-5-[[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]methyl]hepta-1,3,5-trien-4-ol.
| Compound Name | (3E,5Z)-5-[[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]methyl]hepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 155184988 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (3E,5Z)-5-[[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]methyl]hepta-1,3,5-trien-4-ol |
| SMILES | C=C/C=C(O)\C(=C/C)CNC(/C=C\C)=C/C |
| InChI | InChI=1S/C14H21NO/c1-5-9-13(8-4)15-11-12(7-3)14(16)10-6-2/h5-10,15-16H,2,11H2,1,3-4H3/b9-5-,12-7-,13-8+,14-10+ |
| InChIKey | UBKMAOSAIMMJRB-HEYSYOMWSA-N |
| XLogP | 3.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|