About 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine
3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine (PubChem CID 155185066) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine.
Molecular Properties
| Compound Name | 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine |
| PubChem CID | 155185066 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine |
| SMILES | CC(C)C1=CC2N=C(N)C(C)(C)C2C=C1 |
| InChI | InChI=1S/C13H20N2/c1-8(2)9-5-6-10-11(7-9)15-12(14)13(10,3)4/h5-8,10-11H,1-4H3,(H2,14,15) |
| InChIKey | FVDZPUDZCZGKAN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine?
The IUPAC name of 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine (CID 155185066) is 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine.
What is the SMILES notation for 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine?
The canonical SMILES for 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine is CC(C)C1=CC2N=C(N)C(C)(C)C2C=C1.
What is the InChIKey of 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine?
The InChIKey is FVDZPUDZCZGKAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-8(2)9-5-6-10-11(7-9)15-12(14)13(10,3)4/h5-8,10-11H,1-4H3,(H2,14,15).
What are the key properties of 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine?
3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine has a molecular weight of 204.32 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-6-propan-2-yl-3a,7a-dihydroindol-2-amine is sourced from PubChem (CID 155185066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).