About 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline
2,3-dichloro-7-(2,2-dimethylpropyl)quinoline (PubChem CID 155185194) has the molecular formula C14H15Cl2N
and a molecular weight of 268.19 g/mol. Its IUPAC name is 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline.
Molecular Properties
| Compound Name | 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline |
| PubChem CID | 155185194 |
| Molecular Formula | C14H15Cl2N |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline |
| SMILES | CC(C)(C)Cc1ccc2cc(Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C14H15Cl2N/c1-14(2,3)8-9-4-5-10-7-11(15)13(16)17-12(10)6-9/h4-7H,8H2,1-3H3 |
| InChIKey | WWINHMGUUFVERQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline?
The IUPAC name of 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline (CID 155185194) is 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline.
What is the SMILES notation for 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline?
The canonical SMILES for 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline is CC(C)(C)Cc1ccc2cc(Cl)c(Cl)nc2c1.
What is the InChIKey of 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline?
The InChIKey is WWINHMGUUFVERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N/c1-14(2,3)8-9-4-5-10-7-11(15)13(16)17-12(10)6-9/h4-7H,8H2,1-3H3.
What are the key properties of 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline?
2,3-dichloro-7-(2,2-dimethylpropyl)quinoline has a molecular weight of 268.19 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-7-(2,2-dimethylpropyl)quinoline is sourced from PubChem (CID 155185194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).