C15H23F9N4O3 — CID 155185623
2,2,2-trifluoro-N-[3-[3-[(2,2,2-trifluoroacetyl)-[3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propyl]amino]propylamino]propyl]acetamide (PubChem CID 155185623) has the molecular formula C15H23F9N4O3 and a molecular weight of 478.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[3-[(2,2,2-trifluoroacetyl)-[3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propyl]amino]propylamino]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[3-[(2,2,2-trifluoroacetyl)-[3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propyl]amino]propylamino]propyl]acetamide |
|---|---|
| PubChem CID | 155185623 |
| Molecular Formula | C15H23F9N4O3 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[3-[(2,2,2-trifluoroacetyl)-[3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propyl]amino]propylamino]propyl]acetamide |
| SMILES | O=C(NCCCNCCCN(CCCNC(O)C(F)(F)F)C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H23F9N4O3/c16-13(17,18)10(29)26-6-1-4-25-5-2-8-28(12(31)15(22,23)24)9-3-7-27-11(30)14(19,20)21/h11,25,27,30H,1-9H2,(H,26,29) |
| InChIKey | TXIFDIYAJUFMMM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|