C26H37N5O2S — CID 155185725
(2R)-2-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-4-methyl-N-(1,3-thiazol-5-ylmethyl)pentanamide (PubChem CID 155185725) has the molecular formula C26H37N5O2S and a molecular weight of 483.68 g/mol. Its IUPAC name is (2R)-2-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-4-methyl-N-(1,3-thiazol-5-ylmethyl)pentanamide.
| Compound Name | (2R)-2-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-4-methyl-N-(1,3-thiazol-5-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 155185725 |
| Molecular Formula | C26H37N5O2S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (2R)-2-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-4-methyl-N-(1,3-thiazol-5-ylmethyl)pentanamide |
| SMILES | CC(C)C[C@H](C(=O)NCc1cncs1)N1CCC(CCc2ccccc2)N2C[C@H](N)C[C@H]2C1=O |
| InChI | InChI=1S/C26H37N5O2S/c1-18(2)12-23(25(32)29-15-22-14-28-17-34-22)30-11-10-21(9-8-19-6-4-3-5-7-19)31-16-20(27)13-24(31)26(30)33/h3-7,14,17-18,20-21,23-24H,8-13,15-16,27H2,1-2H3,(H,29,32)/t20-,21?,23-,24+/m1/s1 |
| InChIKey | IEFDLLFGFUNQGA-FXXYKOEOSA-N |
| XLogP | 2.81 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |