C11H14N4O5S — CID 155186069
(2S,3S,5R)-3,5-dimethyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 155186069) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is (2S,3S,5R)-3,5-dimethyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3S,5R)-3,5-dimethyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 155186069 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2S,3S,5R)-3,5-dimethyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@]1(Cn2ccnn2)[C@H](C(=O)O)N2C(=O)C[C@@]2(C)S1(=O)=O |
| InChI | InChI=1S/C11H14N4O5S/c1-10(6-14-4-3-12-13-14)8(9(17)18)15-7(16)5-11(15,2)21(10,19)20/h3-4,8H,5-6H2,1-2H3,(H,17,18)/t8-,10-,11+/m0/s1 |
| InChIKey | DJDMWAMDWQTIAB-INTQDDNPSA-N |
| XLogP | -1.13 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |