C20H19FN2O — CID 155186187
1-fluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one (PubChem CID 155186187) has the molecular formula C20H19FN2O and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-fluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one.
| Compound Name | 1-fluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one |
|---|---|
| PubChem CID | 155186187 |
| Molecular Formula | C20H19FN2O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-fluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one |
| SMILES | CN1CC2CN(c3ccc4c(c3)C(=O)c3c(F)cccc3-4)CC2C1 |
| InChI | InChI=1S/C20H19FN2O/c1-22-8-12-10-23(11-13(12)9-22)14-5-6-15-16-3-2-4-18(21)19(16)20(24)17(15)7-14/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | PBPIHVFJISKYDY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |