C13H22N4O — CID 155186756
N-[3-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)propyl]acetamide (PubChem CID 155186756) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is N-[3-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)propyl]acetamide.
| Compound Name | N-[3-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)propyl]acetamide |
|---|---|
| PubChem CID | 155186756 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-[3-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)propyl]acetamide |
| SMILES | CC(=O)NCCCn1nnc2c1CCCCCC2 |
| InChI | InChI=1S/C13H22N4O/c1-11(18)14-9-6-10-17-13-8-5-3-2-4-7-12(13)15-16-17/h2-10H2,1H3,(H,14,18) |
| InChIKey | NDYVQZTWPUJDBI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|