About (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine
(1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine (PubChem CID 155187113) has the molecular formula C17H25ClN2
and a molecular weight of 292.85 g/mol. Its IUPAC name is (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine.
Molecular Properties
| Compound Name | (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
| PubChem CID | 155187113 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
| SMILES | CC(C)(C)N1CCC2(CC1)Cc1cc(Cl)ccc1[C@H]2N |
| InChI | InChI=1S/C17H25ClN2/c1-16(2,3)20-8-6-17(7-9-20)11-12-10-13(18)4-5-14(12)15(17)19/h4-5,10,15H,6-9,11,19H2,1-3H3/t15-/m1/s1 |
| InChIKey | KKXKAVHBICIRKF-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
The IUPAC name of (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine (CID 155187113) is (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine.
What is the SMILES notation for (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
The canonical SMILES for (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine is CC(C)(C)N1CCC2(CC1)Cc1cc(Cl)ccc1[C@H]2N.
What is the InChIKey of (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
The InChIKey is KKXKAVHBICIRKF-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H25ClN2/c1-16(2,3)20-8-6-17(7-9-20)11-12-10-13(18)4-5-14(12)15(17)19/h4-5,10,15H,6-9,11,19H2,1-3H3/t15-/m1/s1.
What are the key properties of (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
(1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine has a molecular weight of 292.85 g/mol, XLogP of 3.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1'-tert-butyl-5-chlorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine is sourced from PubChem (CID 155187113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).