About 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one
3-hydroxy-3,5-dimethyl-2H-isoindol-1-one (PubChem CID 155187215) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one |
| PubChem CID | 155187215 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one |
| SMILES | Cc1ccc2c(c1)C(C)(O)NC2=O |
| InChI | InChI=1S/C10H11NO2/c1-6-3-4-7-8(5-6)10(2,13)11-9(7)12/h3-5,13H,1-2H3,(H,11,12) |
| InChIKey | CGMLAGRSUKDGOM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one?
The IUPAC name of 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one (CID 155187215) is 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one.
What is the SMILES notation for 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one?
The canonical SMILES for 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one is Cc1ccc2c(c1)C(C)(O)NC2=O.
What is the InChIKey of 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one?
The InChIKey is CGMLAGRSUKDGOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-6-3-4-7-8(5-6)10(2,13)11-9(7)12/h3-5,13H,1-2H3,(H,11,12).
What are the key properties of 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one?
3-hydroxy-3,5-dimethyl-2H-isoindol-1-one has a molecular weight of 177.20 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3,5-dimethyl-2H-isoindol-1-one is sourced from PubChem (CID 155187215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).