C18H17F3N4O — CID 155187500
[(1R,2S)-1-[[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]methanol (PubChem CID 155187500) has the molecular formula C18H17F3N4O and a molecular weight of 362.36 g/mol. Its IUPAC name is [(1R,2S)-1-[[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]methanol.
| Compound Name | [(1R,2S)-1-[[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 155187500 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(1R,2S)-1-[[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]methanol |
| SMILES | OC[C@H]1CCc2ccccc2[C@@H]1Nc1ncnc2[nH]c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C18H17F3N4O/c19-18(20,21)14-7-13-16(24-14)22-9-23-17(13)25-15-11(8-26)6-5-10-3-1-2-4-12(10)15/h1-4,7,9,11,15,26H,5-6,8H2,(H2,22,23,24,25)/t11-,15-/m1/s1 |
| InChIKey | PVXVMWINPJXGSI-IAQYHMDHSA-N |
| XLogP | 3.68 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |