C19H19F3N4 — CID 155187588
N-[(1R,2R)-2-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155187588) has the molecular formula C19H19F3N4 and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[(1R,2R)-2-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1R,2R)-2-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155187588 |
| Molecular Formula | C19H19F3N4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(1R,2R)-2-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC[C@@H]1CCc2ccccc2[C@@H]1Nc1ncnc2[nH]c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C19H19F3N4/c1-2-11-7-8-12-5-3-4-6-13(12)16(11)26-18-14-9-15(19(20,21)22)25-17(14)23-10-24-18/h3-6,9-11,16H,2,7-8H2,1H3,(H2,23,24,25,26)/t11-,16-/m1/s1 |
| InChIKey | UEPDUBBQCYCRQK-BDJLRTHQSA-N |
| XLogP | 5.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |