C19H20F3N5 — CID 155187604
(1S,2S)-2-N,2-N-dimethyl-1-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalene-1,2-diamine (PubChem CID 155187604) has the molecular formula C19H20F3N5 and a molecular weight of 375.40 g/mol. Its IUPAC name is (1S,2S)-2-N,2-N-dimethyl-1-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalene-1,2-diamine.
| Compound Name | (1S,2S)-2-N,2-N-dimethyl-1-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
|---|---|
| PubChem CID | 155187604 |
| Molecular Formula | C19H20F3N5 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (1S,2S)-2-N,2-N-dimethyl-1-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
| SMILES | CN(C)[C@H]1CCc2ccccc2[C@@H]1Nc1ncnc2[nH]c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C19H20F3N5/c1-27(2)14-8-7-11-5-3-4-6-12(11)16(14)26-18-13-9-15(19(20,21)22)25-17(13)23-10-24-18/h3-6,9-10,14,16H,7-8H2,1-2H3,(H2,23,24,25,26)/t14-,16-/m0/s1 |
| InChIKey | XIBRCUHJWJSKBQ-HOCLYGCPSA-N |
| XLogP | 4.01 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |