C14H19NOSe — CID 15518771
(4R,6S)-2-(4-methylphenyl)-6-propyl-5,6-dihydro-4H-1,3-selenazin-4-ol (PubChem CID 15518771) has the molecular formula C14H19NOSe and a molecular weight of 296.27 g/mol. Its IUPAC name is (4R,6S)-2-(4-methylphenyl)-6-propyl-5,6-dihydro-4H-1,3-selenazin-4-ol.
| Compound Name | (4R,6S)-2-(4-methylphenyl)-6-propyl-5,6-dihydro-4H-1,3-selenazin-4-ol |
|---|---|
| PubChem CID | 15518771 |
| Molecular Formula | C14H19NOSe |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (4R,6S)-2-(4-methylphenyl)-6-propyl-5,6-dihydro-4H-1,3-selenazin-4-ol |
| SMILES | CCC[C@H]1C[C@@H](O)N=C(c2ccc(C)cc2)[Se]1 |
| InChI | InChI=1S/C14H19NOSe/c1-3-4-12-9-13(16)15-14(17-12)11-7-5-10(2)6-8-11/h5-8,12-13,16H,3-4,9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | HOADNDOTFBKGMM-QWHCGFSZSA-N |
| XLogP | 2.76 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|