C24H20F2N2O5 — CID 155187841
3-[6-[[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-hydroxymethyl]amino]-3-methyl-2-pyridinyl]benzoic acid (PubChem CID 155187841) has the molecular formula C24H20F2N2O5 and a molecular weight of 454.43 g/mol. Its IUPAC name is 3-[6-[[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-hydroxymethyl]amino]-3-methyl-2-pyridinyl]benzoic acid.
| Compound Name | 3-[6-[[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-hydroxymethyl]amino]-3-methyl-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 155187841 |
| Molecular Formula | C24H20F2N2O5 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 3-[6-[[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-hydroxymethyl]amino]-3-methyl-2-pyridinyl]benzoic acid |
| SMILES | Cc1ccc(NC(O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)nc1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H20F2N2O5/c1-13-5-8-19(27-20(13)14-3-2-4-15(11-14)21(29)30)28-22(31)23(9-10-23)16-6-7-17-18(12-16)33-24(25,26)32-17/h2-8,11-12,22,31H,9-10H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | YPMKQDVGNAWHBD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|