About 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide
1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide (PubChem CID 155187964) has the molecular formula C6H8F3N3O3S
and a molecular weight of 259.21 g/mol. Its IUPAC name is 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide |
| PubChem CID | 155187964 |
| Molecular Formula | C6H8F3N3O3S |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cn(CC(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C6H8F3N3O3S/c7-6(8,9)4(13)1-12-2-5(11-3-12)16(10,14)15/h2-4,13H,1H2,(H2,10,14,15) |
| InChIKey | GQWXBIPQLZCNJR-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide?
The IUPAC name of 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide (CID 155187964) is 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide.
What is the SMILES notation for 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide?
The canonical SMILES for 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide is NS(=O)(=O)c1cn(CC(O)C(F)(F)F)cn1.
What is the InChIKey of 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide?
The InChIKey is GQWXBIPQLZCNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3N3O3S/c7-6(8,9)4(13)1-12-2-5(11-3-12)16(10,14)15/h2-4,13H,1H2,(H2,10,14,15).
What are the key properties of 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide?
1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide has a molecular weight of 259.21 g/mol, XLogP of -0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3,3-trifluoro-2-hydroxypropyl)imidazole-4-sulfonamide is sourced from PubChem (CID 155187964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).